About 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one
6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one (PubChem CID 72705992) has the molecular formula C18H17NO5
and a molecular weight of 327.34 g/mol. Its IUPAC name is 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one.
Molecular Properties
| Compound Name | 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one |
| PubChem CID | 72705992 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one |
| SMILES | COc1cc2oc(-c3ccc(OC)c(OC)c3)cc(=O)c2cc1N |
| InChI | InChI=1S/C18H17NO5/c1-21-14-5-4-10(6-18(14)23-3)15-8-13(20)11-7-12(19)17(22-2)9-16(11)24-15/h4-9H,19H2,1-3H3 |
| InChIKey | DIKZJSCBGZDJKO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one?
The IUPAC name of 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one (CID 72705992) is 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one.
What is the SMILES notation for 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one?
The canonical SMILES for 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one is COc1cc2oc(-c3ccc(OC)c(OC)c3)cc(=O)c2cc1N.
What is the InChIKey of 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one?
The InChIKey is DIKZJSCBGZDJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO5/c1-21-14-5-4-10(6-18(14)23-3)15-8-13(20)11-7-12(19)17(22-2)9-16(11)24-15/h4-9H,19H2,1-3H3.
What are the key properties of 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one?
6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one has a molecular weight of 327.34 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(3,4-dimethoxyphenyl)-7-methoxychromen-4-one is sourced from PubChem (CID 72705992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).