C12H22N2O3 — CID 72706023
2-[[tert-butyl(methyl)carbamoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 72706023) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[[tert-butyl(methyl)carbamoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[tert-butyl(methyl)carbamoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 72706023 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-[[tert-butyl(methyl)carbamoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)N(C)C(C)(C)C |
| InChI | InChI=1S/C12H22N2O3/c1-9(2)10(15)17-8-7-13-11(16)14(6)12(3,4)5/h1,7-8H2,2-6H3,(H,13,16) |
| InChIKey | KUYYSYVPIKMQSW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|