C16H15F3N6 — CID 72706416
5-methyl-2-N-(1-methylpyrazol-4-yl)-4-N-[(2,3,5-trifluorophenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 72706416) has the molecular formula C16H15F3N6 and a molecular weight of 348.33 g/mol. Its IUPAC name is 5-methyl-2-N-(1-methylpyrazol-4-yl)-4-N-[(2,3,5-trifluorophenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-2-N-(1-methylpyrazol-4-yl)-4-N-[(2,3,5-trifluorophenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72706416 |
| Molecular Formula | C16H15F3N6 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 5-methyl-2-N-(1-methylpyrazol-4-yl)-4-N-[(2,3,5-trifluorophenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2cnn(C)c2)nc1NCc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C16H15F3N6/c1-9-5-21-16(23-12-7-22-25(2)8-12)24-15(9)20-6-10-3-11(17)4-13(18)14(10)19/h3-5,7-8H,6H2,1-2H3,(H2,20,21,23,24) |
| InChIKey | IKRMBWXXGBBRDY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|