About 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene
5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene (PubChem CID 72706663) has the molecular formula C10H13FN2O2S
and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene |
| PubChem CID | 72706663 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene |
| SMILES | Cc1cc(F)cc2c1C(NS(N)(=O)=O)CC2 |
| InChI | InChI=1S/C10H13FN2O2S/c1-6-4-8(11)5-7-2-3-9(10(6)7)13-16(12,14)15/h4-5,9,13H,2-3H2,1H3,(H2,12,14,15) |
| InChIKey | HPMROXGRHJKWFL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene?
The IUPAC name of 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene (CID 72706663) is 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene?
The canonical SMILES for 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene is Cc1cc(F)cc2c1C(NS(N)(=O)=O)CC2.
What is the InChIKey of 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene?
The InChIKey is HPMROXGRHJKWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O2S/c1-6-4-8(11)5-7-2-3-9(10(6)7)13-16(12,14)15/h4-5,9,13H,2-3H2,1H3,(H2,12,14,15).
What are the key properties of 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene?
5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene has a molecular weight of 244.29 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-7-methyl-1-(sulfamoylamino)-2,3-dihydro-1H-indene is sourced from PubChem (CID 72706663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).