C26H34N2O8 — CID 72706952
2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]acetic acid;N,N-diethylethanamine (PubChem CID 72706952) has the molecular formula C26H34N2O8 and a molecular weight of 502.56 g/mol. Its IUPAC name is 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]acetic acid;N,N-diethylethanamine.
| Compound Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]acetic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 72706952 |
| Molecular Formula | C26H34N2O8 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 2-[[(1E)-1-[(9bR)-6-acetyl-7,9-dihydroxy-8,9b-dimethyl-1,3-dioxodibenzofuran-2-ylidene]ethyl]amino]acetic acid;N,N-diethylethanamine |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)NCC(=O)O)C(=O)[C@@]12C.CCN(CC)CC |
| InChI | InChI=1S/C20H19NO8.C6H15N/c1-7-16(26)14(9(3)22)18-15(17(7)27)20(4)11(29-18)5-10(23)13(19(20)28)8(2)21-6-12(24)25;1-4-7(5-2)6-3/h5,21,26-27H,6H2,1-4H3,(H,24,25);4-6H2,1-3H3/b13-8+;/t20-;/m0./s1 |
| InChIKey | DDJGNOFFDSPNCH-PRYJTZKFSA-N |
| XLogP | 2.59 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|