About 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate
2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate (PubChem CID 72707556) has the molecular formula C6H11NO4S2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
| PubChem CID | 72707556 |
| Molecular Formula | C6H11NO4S2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC[C@@H]1CNC(=S)O1 |
| InChI | InChI=1S/C6H11NO4S2/c1-13(8,9)10-3-2-5-4-7-6(12)11-5/h5H,2-4H2,1H3,(H,7,12)/t5-/m1/s1 |
| InChIKey | BGBMBXAFBQVUSX-RXMQYKEDSA-N |
| XLogP | -0.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate?
The IUPAC name of 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate (CID 72707556) is 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate.
What is the SMILES notation for 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate?
The canonical SMILES for 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate is CS(=O)(=O)OCC[C@@H]1CNC(=S)O1.
What is the InChIKey of 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate?
The InChIKey is BGBMBXAFBQVUSX-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11NO4S2/c1-13(8,9)10-3-2-5-4-7-6(12)11-5/h5H,2-4H2,1H3,(H,7,12)/t5-/m1/s1.
What are the key properties of 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate?
2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate has a molecular weight of 225.29 g/mol, XLogP of -0.37, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5R)-2-sulfanylidene-1,3-oxazolidin-5-yl]ethyl methanesulfonate is sourced from PubChem (CID 72707556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).