C34H26N2O3 — CID 72707654
[5-[bis(1H-indol-3-yl)methyl]-7-methyl-1-benzofuran-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 72707654) has the molecular formula C34H26N2O3 and a molecular weight of 510.59 g/mol. Its IUPAC name is [5-[bis(1H-indol-3-yl)methyl]-7-methyl-1-benzofuran-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [5-[bis(1H-indol-3-yl)methyl]-7-methyl-1-benzofuran-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 72707654 |
| Molecular Formula | C34H26N2O3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | [5-[bis(1H-indol-3-yl)methyl]-7-methyl-1-benzofuran-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2cc3cc(C(c4c[nH]c5ccccc45)c4c[nH]c5ccccc45)cc(C)c3o2)cc1 |
| InChI | InChI=1S/C34H26N2O3/c1-20-15-22(16-23-17-31(39-34(20)23)33(37)21-11-13-24(38-2)14-12-21)32(27-18-35-29-9-5-3-7-25(27)29)28-19-36-30-10-6-4-8-26(28)30/h3-19,32,35-36H,1-2H3 |
| InChIKey | ZAGRKSMHLQCLMR-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 71.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |