About 3-(4-fluorophenyl)-N,3-dihydroxypropanamide
3-(4-fluorophenyl)-N,3-dihydroxypropanamide (PubChem CID 72707668) has the molecular formula C9H10FNO3
and a molecular weight of 199.18 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-N,3-dihydroxypropanamide |
| PubChem CID | 72707668 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(4-fluorophenyl)-N,3-dihydroxypropanamide |
| SMILES | O=C(CC(O)c1ccc(F)cc1)NO |
| InChI | InChI=1S/C9H10FNO3/c10-7-3-1-6(2-4-7)8(12)5-9(13)11-14/h1-4,8,12,14H,5H2,(H,11,13) |
| InChIKey | FSKOQKSDUBTQCK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)-N,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-N,3-dihydroxypropanamide?
The IUPAC name of 3-(4-fluorophenyl)-N,3-dihydroxypropanamide (CID 72707668) is 3-(4-fluorophenyl)-N,3-dihydroxypropanamide.
What is the SMILES notation for 3-(4-fluorophenyl)-N,3-dihydroxypropanamide?
The canonical SMILES for 3-(4-fluorophenyl)-N,3-dihydroxypropanamide is O=C(CC(O)c1ccc(F)cc1)NO.
What is the InChIKey of 3-(4-fluorophenyl)-N,3-dihydroxypropanamide?
The InChIKey is FSKOQKSDUBTQCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO3/c10-7-3-1-6(2-4-7)8(12)5-9(13)11-14/h1-4,8,12,14H,5H2,(H,11,13).
What are the key properties of 3-(4-fluorophenyl)-N,3-dihydroxypropanamide?
3-(4-fluorophenyl)-N,3-dihydroxypropanamide has a molecular weight of 199.18 g/mol, XLogP of 0.75, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-N,3-dihydroxypropanamide is sourced from PubChem (CID 72707668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).