C44H28F5N2P — CID 72707685
[1-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]naphthalen-2-yl]-diphenylphosphane (PubChem CID 72707685) has the molecular formula C44H28F5N2P and a molecular weight of 710.69 g/mol. Its IUPAC name is [1-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]naphthalen-2-yl]-diphenylphosphane.
| Compound Name | [1-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]naphthalen-2-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 72707685 |
| Molecular Formula | C44H28F5N2P |
| Molecular Weight | 710.69 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | [1-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]-4,5-diphenylimidazol-2-yl]naphthalen-2-yl]-diphenylphosphane |
| SMILES | Fc1c(F)c(F)c(Cn2c(-c3c(P(c4ccccc4)c4ccccc4)ccc4ccccc34)nc(-c3ccccc3)c2-c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C44H28F5N2P/c45-37-34(38(46)40(48)41(49)39(37)47)27-51-43(30-18-7-2-8-19-30)42(29-16-5-1-6-17-29)50-44(51)36-33-24-14-13-15-28(33)25-26-35(36)52(31-20-9-3-10-21-31)32-22-11-4-12-23-32/h1-26H,27H2 |
| InChIKey | QFGAWCQIZYUPDE-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.69 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|