C25H31F3O7SSi — CID 72707692
[(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate (PubChem CID 72707692) has the molecular formula C25H31F3O7SSi and a molecular weight of 560.66 g/mol. Its IUPAC name is [(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 72707692 |
| Molecular Formula | C25H31F3O7SSi |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | [(3aS,5R,6S,6aS)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](OS(=O)(=O)C(F)(F)F)[C@@H]2O1 |
| InChI | InChI=1S/C25H31F3O7SSi/c1-23(2,3)37(17-12-8-6-9-13-17,18-14-10-7-11-15-18)31-16-19-20(35-36(29,30)25(26,27)28)21-22(32-19)34-24(4,5)33-21/h6-15,19-22H,16H2,1-5H3/t19-,20+,21+,22+/m1/s1 |
| InChIKey | GRDFFXAVCOTVTG-MLNNCEHLSA-N |
| XLogP | 3.67 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|