C15H21NO4 — CID 72707771
ethyl (2R,3S)-2,3-dihydroxy-3-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate (PubChem CID 72707771) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethyl (2R,3S)-2,3-dihydroxy-3-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate.
| Compound Name | ethyl (2R,3S)-2,3-dihydroxy-3-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate |
|---|---|
| PubChem CID | 72707771 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | ethyl (2R,3S)-2,3-dihydroxy-3-[(2R)-1-[(1R)-1-phenylethyl]aziridin-2-yl]propanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](O)[C@H]1CN1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H21NO4/c1-3-20-15(19)14(18)13(17)12-9-16(12)10(2)11-7-5-4-6-8-11/h4-8,10,12-14,17-18H,3,9H2,1-2H3/t10-,12-,13+,14-,16?/m1/s1 |
| InChIKey | LOCSCVANSITPEN-VQKLLNHBSA-N |
| XLogP | 0.72 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|