C34H39NO4 — CID 72707772
(2R,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentan-1-ol (PubChem CID 72707772) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is (2R,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentan-1-ol.
| Compound Name | (2R,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 72707772 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (2R,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentan-1-ol |
| SMILES | C[C@@H](N[C@H](CO)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H39NO4/c1-27(31-20-12-5-13-21-31)35-32(22-36)34(39-25-30-18-10-4-11-19-30)33(38-24-29-16-8-3-9-17-29)26-37-23-28-14-6-2-7-15-28/h2-21,27,32-36H,22-26H2,1H3/t27-,32-,33+,34+/m1/s1 |
| InChIKey | LMKFQTNRGKQOMA-YIJGCRFNSA-N |
| XLogP | 6.09 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |