C34H37NO5 — CID 72707773
(2S,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentanoic acid (PubChem CID 72707773) has the molecular formula C34H37NO5 and a molecular weight of 539.67 g/mol. Its IUPAC name is (2S,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentanoic acid.
| Compound Name | (2S,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentanoic acid |
|---|---|
| PubChem CID | 72707773 |
| Molecular Formula | C34H37NO5 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (2S,3S,4S)-2-[[(1R)-1-phenylethyl]amino]-3,4,5-tris(phenylmethoxy)pentanoic acid |
| SMILES | C[C@@H](N[C@H](C(=O)O)[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37NO5/c1-26(30-20-12-5-13-21-30)35-32(34(36)37)33(40-24-29-18-10-4-11-19-29)31(39-23-28-16-8-3-9-17-28)25-38-22-27-14-6-2-7-15-27/h2-21,26,31-33,35H,22-25H2,1H3,(H,36,37)/t26-,31+,32+,33-/m1/s1 |
| InChIKey | LIXHLIMXHZWOQK-RVLOQZQWSA-N |
| XLogP | 6.18 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |