About (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol
(2S)-1,1-diethoxy-4-nitrobutane-2,3-diol (PubChem CID 72707825) has the molecular formula C8H17NO6
and a molecular weight of 223.22 g/mol. Its IUPAC name is (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol.
Molecular Properties
| Compound Name | (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol |
| PubChem CID | 72707825 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol |
| SMILES | CCOC(OCC)[C@@H](O)C(O)C[N+](=O)[O-] |
| InChI | InChI=1S/C8H17NO6/c1-3-14-8(15-4-2)7(11)6(10)5-9(12)13/h6-8,10-11H,3-5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | JEEJJTDTJONRDN-MLWJPKLSSA-N |
| XLogP | -0.62 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol?
The IUPAC name of (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol (CID 72707825) is (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol.
What is the SMILES notation for (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol?
The canonical SMILES for (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol is CCOC(OCC)[C@@H](O)C(O)C[N+](=O)[O-].
What is the InChIKey of (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol?
The InChIKey is JEEJJTDTJONRDN-MLWJPKLSSA-N. The full InChI is InChI=1S/C8H17NO6/c1-3-14-8(15-4-2)7(11)6(10)5-9(12)13/h6-8,10-11H,3-5H2,1-2H3/t6?,7-/m0/s1.
What are the key properties of (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol?
(2S)-1,1-diethoxy-4-nitrobutane-2,3-diol has a molecular weight of 223.22 g/mol, XLogP of -0.62, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-diethoxy-4-nitrobutane-2,3-diol is sourced from PubChem (CID 72707825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).