C32H41N3O4 — CID 72707919
methyl (2S)-3-(3-decylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 72707919) has the molecular formula C32H41N3O4 and a molecular weight of 531.70 g/mol. Its IUPAC name is methyl (2S)-3-(3-decylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(3-decylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 72707919 |
| Molecular Formula | C32H41N3O4 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | methyl (2S)-3-(3-decylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CCCCCCCCCCn1cncc1C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C32H41N3O4/c1-3-4-5-6-7-8-9-14-19-35-23-33-21-24(35)20-30(31(36)38-2)34-32(37)39-22-29-27-17-12-10-15-25(27)26-16-11-13-18-28(26)29/h10-13,15-18,21,23,29-30H,3-9,14,19-20,22H2,1-2H3,(H,34,37)/t30-/m0/s1 |
| InChIKey | OITNSCGPTQMURD-PMERELPUSA-N |
| XLogP | 6.65 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|