C23H24N2O3 — CID 72708003
15-amino-13-butyl-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one (PubChem CID 72708003) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 15-amino-13-butyl-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one.
| Compound Name | 15-amino-13-butyl-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one |
|---|---|
| PubChem CID | 72708003 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 15-amino-13-butyl-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one |
| SMILES | CCCCC1c2c(nc3c(c2N)CCCC3)Oc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C23H24N2O3/c1-2-3-8-15-18-20(24)13-9-4-6-11-16(13)25-22(18)28-21-14-10-5-7-12-17(14)27-23(26)19(15)21/h5,7,10,12,15H,2-4,6,8-9,11H2,1H3,(H2,24,25) |
| InChIKey | XSENQSLYGBWOAD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|