C21H36O5 — CID 72708011
[(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-hydroxyhex-5-enoate (PubChem CID 72708011) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-hydroxyhex-5-enoate.
| Compound Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-hydroxyhex-5-enoate |
|---|---|
| PubChem CID | 72708011 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-hydroxyhex-5-enoate |
| SMILES | C=C[C@@H](O)CCC(=O)O[C@H](CCCCCCC)[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C21H36O5/c1-6-9-10-11-12-13-18(24-19(23)15-14-16(22)7-2)20-17(8-3)25-21(4,5)26-20/h7-8,16-18,20,22H,2-3,6,9-15H2,1,4-5H3/t16-,17+,18-,20+/m1/s1 |
| InChIKey | FOKJEKAANUSMHG-RMJJICAUSA-N |
| XLogP | 4.29 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|