About [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene
[3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene (PubChem CID 72708013) has the molecular formula C23H20F2O3S
and a molecular weight of 414.47 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene.
Molecular Properties
| Compound Name | [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene |
| PubChem CID | 72708013 |
| Molecular Formula | C23H20F2O3S |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene |
| SMILES | C=C(C(F)(F)C(OCc1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20F2O3S/c1-18(29(26,27)21-15-9-4-10-16-21)23(24,25)22(20-13-7-3-8-14-20)28-17-19-11-5-2-6-12-19/h2-16,22H,1,17H2 |
| InChIKey | BOKLBOOPOPMYLV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene?
The IUPAC name of [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene (CID 72708013) is [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene.
What is the SMILES notation for [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene?
The canonical SMILES for [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene is C=C(C(F)(F)C(OCc1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene?
The InChIKey is BOKLBOOPOPMYLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2O3S/c1-18(29(26,27)21-15-9-4-10-16-21)23(24,25)22(20-13-7-3-8-14-20)28-17-19-11-5-2-6-12-19/h2-16,22H,1,17H2.
What are the key properties of [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene?
[3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene has a molecular weight of 414.47 g/mol, XLogP of 5.57, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(benzenesulfonyl)-2,2-difluoro-1-phenylbut-3-enoxy]methylbenzene is sourced from PubChem (CID 72708013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).