C25H19N3O5 — CID 72708138
15-amino-13-(3-nitrophenyl)-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one (PubChem CID 72708138) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 15-amino-13-(3-nitrophenyl)-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one.
| Compound Name | 15-amino-13-(3-nitrophenyl)-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one |
|---|---|
| PubChem CID | 72708138 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 15-amino-13-(3-nitrophenyl)-2,10-dioxa-22-azapentacyclo[12.8.0.03,12.04,9.016,21]docosa-1(22),3(12),4,6,8,14,16(21)-heptaen-11-one |
| SMILES | Nc1c2c(nc3c1C(c1cccc([N+](=O)[O-])c1)c1c(c4ccccc4oc1=O)O3)CCCC2 |
| InChI | InChI=1S/C25H19N3O5/c26-22-15-8-1-3-10-17(15)27-24-20(22)19(13-6-5-7-14(12-13)28(30)31)21-23(33-24)16-9-2-4-11-18(16)32-25(21)29/h2,4-7,9,11-12,19H,1,3,8,10H2,(H2,26,27) |
| InChIKey | JBAXSCCUCJLJCH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|