C20H32O3 — CID 72708241
2-[[(8R,9R)-9-methyl-8-(3-methylbut-2-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]hex-5-enal (PubChem CID 72708241) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[[(8R,9R)-9-methyl-8-(3-methylbut-2-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]hex-5-enal.
| Compound Name | 2-[[(8R,9R)-9-methyl-8-(3-methylbut-2-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]hex-5-enal |
|---|---|
| PubChem CID | 72708241 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-[[(8R,9R)-9-methyl-8-(3-methylbut-2-enyl)-1,4-dioxaspiro[4.4]nonan-9-yl]methyl]hex-5-enal |
| SMILES | C=CCCC(C=O)C[C@]1(C)[C@@H](CC=C(C)C)CCC12OCCO2 |
| InChI | InChI=1S/C20H32O3/c1-5-6-7-17(15-21)14-19(4)18(9-8-16(2)3)10-11-20(19)22-12-13-23-20/h5,8,15,17-18H,1,6-7,9-14H2,2-4H3/t17?,18-,19+/m0/s1 |
| InChIKey | GUCZUWBMMJCUNP-JLMCIHFGSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|