About 2-piperidin-1-ylethyl 4-butoxybenzoate
2-piperidin-1-ylethyl 4-butoxybenzoate (PubChem CID 72708355) has the molecular formula C18H27NO3
and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 4-butoxybenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 4-butoxybenzoate |
| PubChem CID | 72708355 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-piperidin-1-ylethyl 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-2-3-14-21-17-9-7-16(8-10-17)18(20)22-15-13-19-11-5-4-6-12-19/h7-10H,2-6,11-15H2,1H3 |
| InChIKey | LBTGXNJGEAITMT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 4-butoxybenzoate?
The IUPAC name of 2-piperidin-1-ylethyl 4-butoxybenzoate (CID 72708355) is 2-piperidin-1-ylethyl 4-butoxybenzoate.
What is the SMILES notation for 2-piperidin-1-ylethyl 4-butoxybenzoate?
The canonical SMILES for 2-piperidin-1-ylethyl 4-butoxybenzoate is CCCCOc1ccc(C(=O)OCCN2CCCCC2)cc1.
What is the InChIKey of 2-piperidin-1-ylethyl 4-butoxybenzoate?
The InChIKey is LBTGXNJGEAITMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO3/c1-2-3-14-21-17-9-7-16(8-10-17)18(20)22-15-13-19-11-5-4-6-12-19/h7-10H,2-6,11-15H2,1H3.
What are the key properties of 2-piperidin-1-ylethyl 4-butoxybenzoate?
2-piperidin-1-ylethyl 4-butoxybenzoate has a molecular weight of 305.42 g/mol, XLogP of 3.51, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 4-butoxybenzoate is sourced from PubChem (CID 72708355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).