C20H21BFNO4S — CID 72708411
1-(benzenesulfonyl)-6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 72708411) has the molecular formula C20H21BFNO4S and a molecular weight of 401.27 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 1-(benzenesulfonyl)-6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 72708411 |
| Molecular Formula | C20H21BFNO4S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 1-(benzenesulfonyl)-6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2cn(S(=O)(=O)c3ccccc3)c3cc(F)ccc23)OC1(C)C |
| InChI | InChI=1S/C20H21BFNO4S/c1-19(2)20(3,4)27-21(26-19)17-13-23(18-12-14(22)10-11-16(17)18)28(24,25)15-8-6-5-7-9-15/h5-13H,1-4H3 |
| InChIKey | TVUAMWPWYLTSBN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|