C31H26ClNO8 — CID 72708476
(5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3,4,5-trimethoxybenzoate chloride (PubChem CID 72708476) has the molecular formula C31H26ClNO8 and a molecular weight of 576.00 g/mol. Its IUPAC name is (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3,4,5-trimethoxybenzoate chloride.
| Compound Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3,4,5-trimethoxybenzoate chloride |
|---|---|
| PubChem CID | 72708476 |
| Molecular Formula | C31H26ClNO8 |
| Molecular Weight | 576.00 g/mol |
| Exact Mass | 575.13 |
| IUPAC Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 3,4,5-trimethoxybenzoate chloride |
| SMILES | COc1cc(C(=O)Oc2c(OC)ccc3c2c[n+]2c4c3ccc3c5c(cc(c34)CC2)OCO5)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C31H26NO8.ClH/c1-34-22-8-7-18-19-5-6-20-26-16(11-25-28(20)39-15-38-25)9-10-32(27(19)26)14-21(18)29(22)40-31(33)17-12-23(35-2)30(37-4)24(13-17)36-3;/h5-8,11-14H,9-10,15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NRHGYLOMIJBBFY-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 85.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.00 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|