C29H20NO7+ — CID 72708512
(5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 1,3-benzodioxole-5-carboxylate (PubChem CID 72708512) has the molecular formula C29H20NO7+ and a molecular weight of 494.48 g/mol. Its IUPAC name is (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 1,3-benzodioxole-5-carboxylate.
| Compound Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 72708512 |
| Molecular Formula | C29H20NO7+ |
| Molecular Weight | 494.48 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (5-methoxy-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaen-6-yl) 1,3-benzodioxole-5-carboxylate |
| SMILES | COc1ccc2c(c[n+]3c4c2ccc2c5c(cc(c24)CC3)OCO5)c1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C29H20NO7/c1-32-22-7-5-17-18-3-4-19-25-15(10-24-27(19)36-14-35-24)8-9-30(26(18)25)12-20(17)28(22)37-29(31)16-2-6-21-23(11-16)34-13-33-21/h2-7,10-12H,8-9,13-14H2,1H3/q+1 |
| InChIKey | MWIQDCCIZWURDJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|