C22H18N4OSe — CID 72708781
6-benzyl-7-(4-ethoxyphenyl)imidazo[4,5-g][2,1,3]benzoselenadiazole (PubChem CID 72708781) has the molecular formula C22H18N4OSe and a molecular weight of 433.37 g/mol. Its IUPAC name is 6-benzyl-7-(4-ethoxyphenyl)imidazo[4,5-g][2,1,3]benzoselenadiazole.
| Compound Name | 6-benzyl-7-(4-ethoxyphenyl)imidazo[4,5-g][2,1,3]benzoselenadiazole |
|---|---|
| PubChem CID | 72708781 |
| Molecular Formula | C22H18N4OSe |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 6-benzyl-7-(4-ethoxyphenyl)imidazo[4,5-g][2,1,3]benzoselenadiazole |
| SMILES | CCOc1ccc(-c2nc3c4n[se]nc4ccc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N4OSe/c1-2-27-17-10-8-16(9-11-17)22-23-21-19(13-12-18-20(21)25-28-24-18)26(22)14-15-6-4-3-5-7-15/h3-13H,2,14H2,1H3 |
| InChIKey | AJBLKXBFQCRQSJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|