C27H28N6O3 — CID 72708790
3-(1-methylindol-3-yl)-4-[1-(4-morpholin-4-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione (PubChem CID 72708790) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-4-[1-(4-morpholin-4-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(1-methylindol-3-yl)-4-[1-(4-morpholin-4-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 72708790 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 3-(1-methylindol-3-yl)-4-[1-(4-morpholin-4-ylbutyl)pyrazolo[5,4-b]pyridin-3-yl]pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3nn(CCCCN4CCOCC4)c4ncccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C27H28N6O3/c1-31-17-20(18-7-2-3-9-21(18)31)22-23(27(35)29-26(22)34)24-19-8-6-10-28-25(19)33(30-24)12-5-4-11-32-13-15-36-16-14-32/h2-3,6-10,17H,4-5,11-16H2,1H3,(H,29,34,35) |
| InChIKey | LSDXOZDAYQCMIO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|