C22H23FIN5O5 — CID 72709007
3-[(1-benzyltriazol-4-yl)methyl]-5-fluoro-1-[6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione (PubChem CID 72709007) has the molecular formula C22H23FIN5O5 and a molecular weight of 583.36 g/mol. Its IUPAC name is 3-[(1-benzyltriazol-4-yl)methyl]-5-fluoro-1-[6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 3-[(1-benzyltriazol-4-yl)methyl]-5-fluoro-1-[6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72709007 |
| Molecular Formula | C22H23FIN5O5 |
| Molecular Weight | 583.36 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 3-[(1-benzyltriazol-4-yl)methyl]-5-fluoro-1-[6-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OC2C(CI)OC(n3cc(F)c(=O)n(Cc4cn(Cc5ccccc5)nn4)c3=O)C2O1 |
| InChI | InChI=1S/C22H23FIN5O5/c1-22(2)33-17-16(8-24)32-20(18(17)34-22)29-12-15(23)19(30)28(21(29)31)11-14-10-27(26-25-14)9-13-6-4-3-5-7-13/h3-7,10,12,16-18,20H,8-9,11H2,1-2H3 |
| InChIKey | WDKWLTKBKCPSSI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 102.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|