C21H23Cl2N5O3 — CID 72709556
1-[2-oxo-2-[(1R,3S,5R)-3-[[(1R)-2,2,2-trideuterio-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide (PubChem CID 72709556) has the molecular formula C21H23Cl2N5O3 and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-[2-oxo-2-[(1R,3S,5R)-3-[[(1R)-2,2,2-trideuterio-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide.
| Compound Name | 1-[2-oxo-2-[(1R,3S,5R)-3-[[(1R)-2,2,2-trideuterio-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 72709556 |
| Molecular Formula | C21H23Cl2N5O3 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[2-oxo-2-[(1R,3S,5R)-3-[[(1R)-2,2,2-trideuterio-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]carbamoyl]-2-azabicyclo[3.1.0]hexan-2-yl]ethyl]indazole-3-carboxamide |
| SMILES | [2H]C([2H])([2H])[C@@H](NC(=O)[C@@H]1C[C@H]2C[C@H]2N1C(=O)Cn1nc(C(N)=O)c2ccccc21)[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C21H23Cl2N5O3/c1-10(13-8-21(13,22)23)25-20(31)16-7-11-6-15(11)28(16)17(29)9-27-14-5-3-2-4-12(14)18(26-27)19(24)30/h2-5,10-11,13,15-16H,6-9H2,1H3,(H2,24,30)(H,25,31)/t10-,11-,13-,15-,16+/m1/s1/i1D3 |
| InChIKey | XHRJLDLLSCUUIL-ZQHWIZQZSA-N |
| XLogP | 1.82 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|