C15H21N3O4S — CID 72709740
2-[4-(1,1-dihydroxypropyl)-3-methyl-5-methylsulfanylpyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 72709740) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[4-(1,1-dihydroxypropyl)-3-methyl-5-methylsulfanylpyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(1,1-dihydroxypropyl)-3-methyl-5-methylsulfanylpyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 72709740 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[4-(1,1-dihydroxypropyl)-3-methyl-5-methylsulfanylpyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCC(O)(O)c1c(C)nn(CC(=O)NCc2ccco2)c1SC |
| InChI | InChI=1S/C15H21N3O4S/c1-4-15(20,21)13-10(2)17-18(14(13)23-3)9-12(19)16-8-11-6-5-7-22-11/h5-7,20-21H,4,8-9H2,1-3H3,(H,16,19) |
| InChIKey | XVBIVSKTCCIKAG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|