C17H32O3 — CID 72710091
(4R)-4-[2-(2,2-diethoxyethoxy)propyl]-1,5,5-trimethylcyclopentene (PubChem CID 72710091) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is (4R)-4-[2-(2,2-diethoxyethoxy)propyl]-1,5,5-trimethylcyclopentene.
| Compound Name | (4R)-4-[2-(2,2-diethoxyethoxy)propyl]-1,5,5-trimethylcyclopentene |
|---|---|
| PubChem CID | 72710091 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | (4R)-4-[2-(2,2-diethoxyethoxy)propyl]-1,5,5-trimethylcyclopentene |
| SMILES | CCOC(COC(C)C[C@H]1CC=C(C)C1(C)C)OCC |
| InChI | InChI=1S/C17H32O3/c1-7-18-16(19-8-2)12-20-14(4)11-15-10-9-13(3)17(15,5)6/h9,14-16H,7-8,10-12H2,1-6H3/t14?,15-/m1/s1 |
| InChIKey | WPKHTUIPHAFEPG-YSSOQSIOSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|