About 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride
1,5,6-trimethylbenzimidazol-2-amine;hydrochloride (PubChem CID 72710310) has the molecular formula C10H14ClN3
and a molecular weight of 211.70 g/mol. Its IUPAC name is 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride |
| PubChem CID | 72710310 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride |
| SMILES | Cc1cc2nc(N)n(C)c2cc1C.Cl |
| InChI | InChI=1S/C10H13N3.ClH/c1-6-4-8-9(5-7(6)2)13(3)10(11)12-8;/h4-5H,1-3H3,(H2,11,12);1H |
| InChIKey | BLILQAHJJGXUDG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride?
The IUPAC name of 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride (CID 72710310) is 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride.
What is the SMILES notation for 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride?
The canonical SMILES for 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride is Cc1cc2nc(N)n(C)c2cc1C.Cl.
What is the InChIKey of 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride?
The InChIKey is BLILQAHJJGXUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.ClH/c1-6-4-8-9(5-7(6)2)13(3)10(11)12-8;/h4-5H,1-3H3,(H2,11,12);1H.
What are the key properties of 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride?
1,5,6-trimethylbenzimidazol-2-amine;hydrochloride has a molecular weight of 211.70 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,6-trimethylbenzimidazol-2-amine;hydrochloride is sourced from PubChem (CID 72710310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).