C18H16N4S — CID 72710521
5-benzyl-6-ethyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 72710521) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 5-benzyl-6-ethyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 5-benzyl-6-ethyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 72710521 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 5-benzyl-6-ethyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | CCc1cccc2c3n[nH]c(=S)nc3n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C18H16N4S/c1-2-13-9-6-10-14-15-17(19-18(23)21-20-15)22(16(13)14)11-12-7-4-3-5-8-12/h3-10H,2,11H2,1H3,(H,19,21,23) |
| InChIKey | NKHHQAUJLLZWLH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|