C23H24O2 — CID 72710726
(1R,2R,3R,4S,5S,7S,8R,9S)-4-[(2E,4E)-5-phenylpenta-2,4-dienyl]tetracyclo[5.4.0.02,5.03,9]undec-10-ene-8-carboxylic acid (PubChem CID 72710726) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S,7S,8R,9S)-4-[(2E,4E)-5-phenylpenta-2,4-dienyl]tetracyclo[5.4.0.02,5.03,9]undec-10-ene-8-carboxylic acid.
| Compound Name | (1R,2R,3R,4S,5S,7S,8R,9S)-4-[(2E,4E)-5-phenylpenta-2,4-dienyl]tetracyclo[5.4.0.02,5.03,9]undec-10-ene-8-carboxylic acid |
|---|---|
| PubChem CID | 72710726 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (1R,2R,3R,4S,5S,7S,8R,9S)-4-[(2E,4E)-5-phenylpenta-2,4-dienyl]tetracyclo[5.4.0.02,5.03,9]undec-10-ene-8-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C2C[C@H]3[C@H](C/C=C/C=C/c4ccccc4)[C@H]4[C@@H]1C=C[C@H]2[C@@H]34 |
| InChI | InChI=1S/C23H24O2/c24-23(25)22-17-12-11-16-19(22)13-18-15(20(17)21(16)18)10-6-2-5-9-14-7-3-1-4-8-14/h1-9,11-12,15-22H,10,13H2,(H,24,25)/b6-2+,9-5+/t15-,16+,17-,18-,19?,20-,21-,22-/m0/s1 |
| InChIKey | HBOLNRUBYUUVLM-HIMBMMDTSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|