C46H38N6O5 — CID 72710733
4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 72710733) has the molecular formula C46H38N6O5 and a molecular weight of 754.85 g/mol. Its IUPAC name is 4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 72710733 |
| Molecular Formula | C46H38N6O5 |
| Molecular Weight | 754.85 g/mol |
| Exact Mass | 754.29 |
| IUPAC Name | 4',5'-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccccc31)c1ccc(O)c(CN(Cc3ccccn3)Cc3ccccn3)c1Oc1c2ccc(O)c1CN(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C46H38N6O5/c53-41-19-17-39-43(36(41)29-51(25-31-11-3-7-21-47-31)26-32-12-4-8-22-48-32)56-44-37(30-52(27-33-13-5-9-23-49-33)28-34-14-6-10-24-50-34)42(54)20-18-40(44)46(39)38-16-2-1-15-35(38)45(55)57-46/h1-24,53-54H,25-30H2 |
| InChIKey | ADUUMQAKJMWDAY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.85 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|