C31H42N2O — CID 72710752
(1S,2R,5R,6R,14R,16R)-N,N,6-trimethyl-5-[(E,2R)-4-(3-methyl-4-pyridinyl)but-3-en-2-yl]-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-9,11-dien-14-amine (PubChem CID 72710752) has the molecular formula C31H42N2O and a molecular weight of 458.69 g/mol. Its IUPAC name is (1S,2R,5R,6R,14R,16R)-N,N,6-trimethyl-5-[(E,2R)-4-(3-methyl-4-pyridinyl)but-3-en-2-yl]-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-9,11-dien-14-amine.
| Compound Name | (1S,2R,5R,6R,14R,16R)-N,N,6-trimethyl-5-[(E,2R)-4-(3-methyl-4-pyridinyl)but-3-en-2-yl]-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-9,11-dien-14-amine |
|---|---|
| PubChem CID | 72710752 |
| Molecular Formula | C31H42N2O |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | (1S,2R,5R,6R,14R,16R)-N,N,6-trimethyl-5-[(E,2R)-4-(3-methyl-4-pyridinyl)but-3-en-2-yl]-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-9,11-dien-14-amine |
| SMILES | Cc1cnccc1/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@]1(C)CCC1=CC3=CC[C@@H](N(C)C)C[C@]34CC[C@@]12O4 |
| InChI | InChI=1S/C31H42N2O/c1-21(6-7-23-13-17-32-20-22(23)2)27-10-11-28-29(27,3)14-12-25-18-24-8-9-26(33(4)5)19-30(24)15-16-31(25,28)34-30/h6-8,13,17-18,20-21,26-28H,9-12,14-16,19H2,1-5H3/b7-6+/t21-,26-,27-,28-,29-,30-,31-/m1/s1 |
| InChIKey | DWEARRASECQSHP-YTQBCWRKSA-N |
| XLogP | 6.74 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |