About 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one
3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one (PubChem CID 72710930) has the molecular formula C10H10N2O3
and a molecular weight of 206.20 g/mol. Its IUPAC name is 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one |
| PubChem CID | 72710930 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one |
| SMILES | COc1nn(Cc2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C10H10N2O3/c1-14-9-11-12(10(13)15-9)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | AUPZIALIBFKSKF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one (CID 72710930) is 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one is COc1nn(Cc2ccccc2)c(=O)o1.
What is the InChIKey of 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one?
The InChIKey is AUPZIALIBFKSKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3/c1-14-9-11-12(10(13)15-9)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one?
3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one has a molecular weight of 206.20 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-methoxy-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 72710930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).