C16H24N2O4 — CID 7271101
2-methoxyethyl N,N-diethyl-N'-(4-methoxybenzoyl)carbamimidate (PubChem CID 7271101) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-methoxyethyl N,N-diethyl-N'-(4-methoxybenzoyl)carbamimidate.
| Compound Name | 2-methoxyethyl N,N-diethyl-N'-(4-methoxybenzoyl)carbamimidate |
|---|---|
| PubChem CID | 7271101 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-methoxyethyl N,N-diethyl-N'-(4-methoxybenzoyl)carbamimidate |
| SMILES | CCN(CC)/C(=N/C(=O)c1ccc(OC)cc1)OCCOC |
| InChI | InChI=1S/C16H24N2O4/c1-5-18(6-2)16(22-12-11-20-3)17-15(19)13-7-9-14(21-4)10-8-13/h7-10H,5-6,11-12H2,1-4H3/b17-16- |
| InChIKey | IAWMXGFRMSWJQG-MSUUIHNZSA-N |
| XLogP | 2.20 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|