C19H17F2NO4 — CID 72711158
ethyl (2Z,5E)-6-[1-[(3,4-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate (PubChem CID 72711158) has the molecular formula C19H17F2NO4 and a molecular weight of 361.34 g/mol. Its IUPAC name is ethyl (2Z,5E)-6-[1-[(3,4-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate.
| Compound Name | ethyl (2Z,5E)-6-[1-[(3,4-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 72711158 |
| Molecular Formula | C19H17F2NO4 |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | ethyl (2Z,5E)-6-[1-[(3,4-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)/C=C/c1cccn1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H17F2NO4/c1-2-26-19(25)18(24)11-15(23)7-6-14-4-3-9-22(14)12-13-5-8-16(20)17(21)10-13/h3-11,24H,2,12H2,1H3/b7-6+,18-11- |
| InChIKey | UYKLPKVIJHNFJX-XWCXEMTOSA-N |
| XLogP | 3.40 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|