About N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide
N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide (PubChem CID 72711190) has the molecular formula C17H20F2N2O
and a molecular weight of 306.36 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide |
| PubChem CID | 72711190 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide |
| SMILES | CC1(C)CCC(NC(=O)c2cc3c(F)cc(F)cc3[nH]2)CC1 |
| InChI | InChI=1S/C17H20F2N2O/c1-17(2)5-3-11(4-6-17)20-16(22)15-9-12-13(19)7-10(18)8-14(12)21-15/h7-9,11,21H,3-6H2,1-2H3,(H,20,22) |
| InChIKey | UATYSFRIVIHVKL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide?
The IUPAC name of N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide (CID 72711190) is N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide is CC1(C)CCC(NC(=O)c2cc3c(F)cc(F)cc3[nH]2)CC1.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide?
The InChIKey is UATYSFRIVIHVKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2O/c1-17(2)5-3-11(4-6-17)20-16(22)15-9-12-13(19)7-10(18)8-14(12)21-15/h7-9,11,21H,3-6H2,1-2H3,(H,20,22).
What are the key properties of N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide?
N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide has a molecular weight of 306.36 g/mol, XLogP of 4.14, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)-4,6-difluoro-1H-indole-2-carboxamide is sourced from PubChem (CID 72711190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).