About 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide
2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide (PubChem CID 72711291) has the molecular formula C14H20F2NO5PS
and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide |
| PubChem CID | 72711291 |
| Molecular Formula | C14H20F2NO5PS |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide |
| SMILES | CCOP(=O)(OCC)C(SCC(=O)N(C)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H20F2NO5PS/c1-4-21-23(20,22-5-2)14(24-9-13(18)17(3)19)10-6-7-11(15)12(16)8-10/h6-8,14,19H,4-5,9H2,1-3H3 |
| InChIKey | NDIPPDHVPYRLCQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide?
The IUPAC name of 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide (CID 72711291) is 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide.
What is the SMILES notation for 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide?
The canonical SMILES for 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide is CCOP(=O)(OCC)C(SCC(=O)N(C)O)c1ccc(F)c(F)c1.
What is the InChIKey of 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide?
The InChIKey is NDIPPDHVPYRLCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2NO5PS/c1-4-21-23(20,22-5-2)14(24-9-13(18)17(3)19)10-6-7-11(15)12(16)8-10/h6-8,14,19H,4-5,9H2,1-3H3.
What are the key properties of 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide?
2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide has a molecular weight of 383.35 g/mol, XLogP of 3.81, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxy-N-methylacetamide is sourced from PubChem (CID 72711291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).