C22H30N2O — CID 72711320
N-[1-[2,6-bis(2-methylpropyl)phenyl]ethyl]pyridine-2-carboxamide (PubChem CID 72711320) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[1-[2,6-bis(2-methylpropyl)phenyl]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[1-[2,6-bis(2-methylpropyl)phenyl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 72711320 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[1-[2,6-bis(2-methylpropyl)phenyl]ethyl]pyridine-2-carboxamide |
| SMILES | CC(C)Cc1cccc(CC(C)C)c1C(C)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C22H30N2O/c1-15(2)13-18-9-8-10-19(14-16(3)4)21(18)17(5)24-22(25)20-11-6-7-12-23-20/h6-12,15-17H,13-14H2,1-5H3,(H,24,25) |
| InChIKey | LOUIUKJMLFRZNB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |