About (1E,3S)-1-bromohexa-1,5-dien-3-ol
(1E,3S)-1-bromohexa-1,5-dien-3-ol (PubChem CID 72711460) has the molecular formula C6H9BrO
and a molecular weight of 177.04 g/mol. Its IUPAC name is (1E,3S)-1-bromohexa-1,5-dien-3-ol.
Molecular Properties
| Compound Name | (1E,3S)-1-bromohexa-1,5-dien-3-ol |
| PubChem CID | 72711460 |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | (1E,3S)-1-bromohexa-1,5-dien-3-ol |
| SMILES | C=CC[C@H](O)/C=C/Br |
| InChI | InChI=1S/C6H9BrO/c1-2-3-6(8)4-5-7/h2,4-6,8H,1,3H2/b5-4+/t6-/m0/s1 |
| InChIKey | XLOVGEFMXBXVHD-OVCGOVNKSA-N |
| XLogP | 1.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3S)-1-bromohexa-1,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3S)-1-bromohexa-1,5-dien-3-ol?
The IUPAC name of (1E,3S)-1-bromohexa-1,5-dien-3-ol (CID 72711460) is (1E,3S)-1-bromohexa-1,5-dien-3-ol.
What is the SMILES notation for (1E,3S)-1-bromohexa-1,5-dien-3-ol?
The canonical SMILES for (1E,3S)-1-bromohexa-1,5-dien-3-ol is C=CC[C@H](O)/C=C/Br.
What is the InChIKey of (1E,3S)-1-bromohexa-1,5-dien-3-ol?
The InChIKey is XLOVGEFMXBXVHD-OVCGOVNKSA-N. The full InChI is InChI=1S/C6H9BrO/c1-2-3-6(8)4-5-7/h2,4-6,8H,1,3H2/b5-4+/t6-/m0/s1.
What are the key properties of (1E,3S)-1-bromohexa-1,5-dien-3-ol?
(1E,3S)-1-bromohexa-1,5-dien-3-ol has a molecular weight of 177.04 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3S)-1-bromohexa-1,5-dien-3-ol is sourced from PubChem (CID 72711460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).