About 2-(2-iodophenyl)triazole
2-(2-iodophenyl)triazole (PubChem CID 72711580) has the molecular formula C8H6IN3
and a molecular weight of 271.06 g/mol. Its IUPAC name is 2-(2-iodophenyl)triazole.
Molecular Properties
| Compound Name | 2-(2-iodophenyl)triazole |
| PubChem CID | 72711580 |
| Molecular Formula | C8H6IN3 |
| Molecular Weight | 271.06 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 2-(2-iodophenyl)triazole |
| SMILES | Ic1ccccc1-n1nccn1 |
| InChI | InChI=1S/C8H6IN3/c9-7-3-1-2-4-8(7)12-10-5-6-11-12/h1-6H |
| InChIKey | QRIZHWOABAVVEB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.06 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-iodophenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-iodophenyl)triazole?
The IUPAC name of 2-(2-iodophenyl)triazole (CID 72711580) is 2-(2-iodophenyl)triazole.
What is the SMILES notation for 2-(2-iodophenyl)triazole?
The canonical SMILES for 2-(2-iodophenyl)triazole is Ic1ccccc1-n1nccn1.
What is the InChIKey of 2-(2-iodophenyl)triazole?
The InChIKey is QRIZHWOABAVVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6IN3/c9-7-3-1-2-4-8(7)12-10-5-6-11-12/h1-6H.
What are the key properties of 2-(2-iodophenyl)triazole?
2-(2-iodophenyl)triazole has a molecular weight of 271.06 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-iodophenyl)triazole is sourced from PubChem (CID 72711580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).