C20H30ClN3O3 — CID 72711725
2-[4-[2-(4-ethylphenoxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride (PubChem CID 72711725) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 2-[4-[2-(4-ethylphenoxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-[2-(4-ethylphenoxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 72711725 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-[4-[2-(4-ethylphenoxy)ethylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
| SMILES | CCc1ccc(OCCNCCCCN2C(=O)C3CCCN3C2=O)cc1.Cl |
| InChI | InChI=1S/C20H29N3O3.ClH/c1-2-16-7-9-17(10-8-16)26-15-12-21-11-3-4-13-23-19(24)18-6-5-14-22(18)20(23)25;/h7-10,18,21H,2-6,11-15H2,1H3;1H |
| InChIKey | YQFQKWFFGQSLOD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|