About N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide
N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide (PubChem CID 72711757) has the molecular formula C16H14FN2O+
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide.
Molecular Properties
| Compound Name | N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide |
| PubChem CID | 72711757 |
| Molecular Formula | C16H14FN2O+ |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide |
| SMILES | O=C(N[N+]1=Cc2ccc(F)cc2CC1)c1ccccc1 |
| InChI | InChI=1S/C16H13FN2O/c17-15-7-6-14-11-19(9-8-13(14)10-15)18-16(20)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2/p+1 |
| InChIKey | UQTBDUJYKNDCMH-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide?
The IUPAC name of N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide (CID 72711757) is N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide.
What is the SMILES notation for N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide?
The canonical SMILES for N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide is O=C(N[N+]1=Cc2ccc(F)cc2CC1)c1ccccc1.
What is the InChIKey of N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide?
The InChIKey is UQTBDUJYKNDCMH-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H13FN2O/c17-15-7-6-14-11-19(9-8-13(14)10-15)18-16(20)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2/p+1.
What are the key properties of N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide?
N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide has a molecular weight of 269.30 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-3,4-dihydroisoquinolin-2-ium-2-yl)benzamide is sourced from PubChem (CID 72711757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).