C16H9F6N5 — CID 72711839
3,5-bis[6-(trifluoromethyl)-3-pyridinyl]pyrazin-2-amine (PubChem CID 72711839) has the molecular formula C16H9F6N5 and a molecular weight of 385.27 g/mol. Its IUPAC name is 3,5-bis[6-(trifluoromethyl)-3-pyridinyl]pyrazin-2-amine.
| Compound Name | 3,5-bis[6-(trifluoromethyl)-3-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 72711839 |
| Molecular Formula | C16H9F6N5 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3,5-bis[6-(trifluoromethyl)-3-pyridinyl]pyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccc(C(F)(F)F)nc2)nc1-c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H9F6N5/c17-15(18,19)11-3-1-8(5-24-11)10-7-26-14(23)13(27-10)9-2-4-12(25-6-9)16(20,21)22/h1-7H,(H2,23,26) |
| InChIKey | CIRJRNWHSTUMGN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |