C15H12BrN3OS — CID 72711894
6-[(4-bromophenyl)methylideneamino]-5,7-dimethyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one (PubChem CID 72711894) has the molecular formula C15H12BrN3OS and a molecular weight of 362.25 g/mol. Its IUPAC name is 6-[(4-bromophenyl)methylideneamino]-5,7-dimethyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one.
| Compound Name | 6-[(4-bromophenyl)methylideneamino]-5,7-dimethyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 72711894 |
| Molecular Formula | C15H12BrN3OS |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 6-[(4-bromophenyl)methylideneamino]-5,7-dimethyl-3H-[1,3]thiazolo[4,5-b]pyridin-2-one |
| SMILES | Cc1nc2[nH]c(=O)sc2c(C)c1/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrN3OS/c1-8-12(17-7-10-3-5-11(16)6-4-10)9(2)18-14-13(8)21-15(20)19-14/h3-7H,1-2H3,(H,18,19,20)/b17-7+ |
| InChIKey | QPYXKKPLNZTODU-REZTVBANSA-N |
| XLogP | 4.11 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|