About N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine
N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine (PubChem CID 72711948) has the molecular formula C24H32FNO
and a molecular weight of 369.52 g/mol. Its IUPAC name is N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine |
| PubChem CID | 72711948 |
| Molecular Formula | C24H32FNO |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine |
| SMILES | CCC1(CC)CC(CCNCc2ccccc2)(c2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C24H32FNO/c1-3-24(4-2)19-23(15-17-27-24,21-10-12-22(25)13-11-21)14-16-26-18-20-8-6-5-7-9-20/h5-13,26H,3-4,14-19H2,1-2H3 |
| InChIKey | STWFUAGIYHEJBN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine?
The IUPAC name of N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine (CID 72711948) is N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine.
What is the SMILES notation for N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine?
The canonical SMILES for N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine is CCC1(CC)CC(CCNCc2ccccc2)(c2ccc(F)cc2)CCO1.
What is the InChIKey of N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine?
The InChIKey is STWFUAGIYHEJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32FNO/c1-3-24(4-2)19-23(15-17-27-24,21-10-12-22(25)13-11-21)14-16-26-18-20-8-6-5-7-9-20/h5-13,26H,3-4,14-19H2,1-2H3.
What are the key properties of N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine?
N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine has a molecular weight of 369.52 g/mol, XLogP of 5.61, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[2,2-diethyl-4-(4-fluorophenyl)oxan-4-yl]ethanamine is sourced from PubChem (CID 72711948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).