C25H28N2O4S — CID 72712169
N-[4-[(E)-2-[3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methoxy-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]phenyl]methanesulfonamide (PubChem CID 72712169) has the molecular formula C25H28N2O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[4-[(E)-2-[3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methoxy-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(E)-2-[3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methoxy-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 72712169 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N-[4-[(E)-2-[3-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methoxy-5-(2-oxo-1H-pyridin-3-yl)phenyl]ethenyl]phenyl]methanesulfonamide |
| SMILES | [2H]C([2H])([2H])C(c1cc(-c2ccc[nH]c2=O)cc(/C=C/c2ccc(NS(C)(=O)=O)cc2)c1OC)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C25H28N2O4S/c1-25(2,3)22-16-19(21-7-6-14-26-24(21)28)15-18(23(22)31-4)11-8-17-9-12-20(13-10-17)27-32(5,29)30/h6-16,27H,1-5H3,(H,26,28)/b11-8+/i1D3,2D3,3D3 |
| InChIKey | IRVBXJQSVGDYQB-XKZXBLITSA-N |
| XLogP | 4.89 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|