About CID 72712281
CID 72712281 (PubChem CID 72712281) has the molecular formula C38H51AuN2O2
and a molecular weight of 764.81 g/mol.
Molecular Properties
| Compound Name | CID 72712281 |
| PubChem CID | 72712281 |
| Molecular Formula | C38H51AuN2O2 |
| Molecular Weight | 764.81 g/mol |
| Exact Mass | 764.36 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C=C1.O=C([O-])C12CC3CC(CC(C3)C1)C2.[Au+] |
| InChI | InChI=1S/C27H36N2.C11H16O2.Au/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;/h9-16,18-21H,1-8H3;7-9H,1-6H2,(H,12,13);/q;;+1/p-1 |
| InChIKey | QSRTTXAUMGFRQW-UHFFFAOYSA-M |
| XLogP | 8.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 764.81 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 72712281 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72712281?
The IUPAC name of CID 72712281 (CID 72712281) is not available.
What is the SMILES notation for CID 72712281?
The canonical SMILES for CID 72712281 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2c(C(C)C)cccc2C(C)C)C=C1.O=C([O-])C12CC3CC(CC(C3)C1)C2.[Au+].
What is the InChIKey of CID 72712281?
The InChIKey is QSRTTXAUMGFRQW-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H36N2.C11H16O2.Au/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;12-10(13)11-4-7-1-8(5-11)3-9(2-7)6-11;/h9-16,18-21H,1-8H3;7-9H,1-6H2,(H,12,13);/q;;+1/p-1.
What are the key properties of CID 72712281?
CID 72712281 has a molecular weight of 764.81 g/mol, XLogP of 8.92, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72712281 is sourced from PubChem (CID 72712281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).